C32H32N2O5S — CID 126177597
N-(3,4-dimethylphenyl)-2-[(5Z)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126177597) has the molecular formula C32H32N2O5S and a molecular weight of 556.68 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[(5Z)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[(5Z)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126177597 |
| Molecular Formula | C32H32N2O5S |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[(5Z)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | C=CCc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(C)c(C)c3)C2=O)cc(OCC)c1OCc1ccccc1 |
| InChI | InChI=1S/C32H32N2O5S/c1-5-10-25-16-24(17-27(38-6-2)30(25)39-20-23-11-8-7-9-12-23)18-28-31(36)34(32(37)40-28)19-29(35)33-26-14-13-21(3)22(4)15-26/h5,7-9,11-18H,1,6,10,19-20H2,2-4H3,(H,33,35)/b28-18- |
| InChIKey | ZDZRLZOJPZZPKR-VEILYXNESA-N |
| XLogP | 6.68 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|