C32H31ClN2O6S — CID 126109951
2-[(5E)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 126109951) has the molecular formula C32H31ClN2O6S and a molecular weight of 607.13 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126109951 |
| Molecular Formula | C32H31ClN2O6S |
| Molecular Weight | 607.13 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | 2-[(5E)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(OCC)cc3)C2=O)cc(OCC)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H31ClN2O6S/c1-4-7-23-16-22(17-27(40-6-3)30(23)41-20-21-8-10-24(33)11-9-21)18-28-31(37)35(32(38)42-28)19-29(36)34-25-12-14-26(15-13-25)39-5-2/h4,8-18H,1,5-7,19-20H2,2-3H3,(H,34,36)/b28-18+ |
| InChIKey | DMSYKHKLLUWWMU-MTDXEUNCSA-N |
| XLogP | 7.12 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.13 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|