C24H24ClNO4S — CID 124663578
(5E)-3-[(4-chlorophenyl)methyl]-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124663578) has the molecular formula C24H24ClNO4S and a molecular weight of 457.98 g/mol. Its IUPAC name is (5E)-3-[(4-chlorophenyl)methyl]-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(4-chlorophenyl)methyl]-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124663578 |
| Molecular Formula | C24H24ClNO4S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | (5E)-3-[(4-chlorophenyl)methyl]-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N(Cc3ccc(Cl)cc3)C2=O)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H24ClNO4S/c1-4-7-18-12-17(13-20(29-5-2)22(18)30-6-3)14-21-23(27)26(24(28)31-21)15-16-8-10-19(25)11-9-16/h4,8-14H,1,5-7,15H2,2-3H3/b21-14+ |
| InChIKey | PWRKXHDTRBRBNB-KGENOOAVSA-N |
| XLogP | 6.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|