C33H28N2O5S — CID 126276734
2-[(5Z)-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide (PubChem CID 126276734) has the molecular formula C33H28N2O5S and a molecular weight of 564.66 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(5Z)-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 126276734 |
| Molecular Formula | C33H28N2O5S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 2-[(5Z)-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide |
| SMILES | C=CCc1cc(/C=C2\SC(=O)N(CC(=O)Nc3cccc4ccccc34)C2=O)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C33H28N2O5S/c1-3-10-25-17-23(18-28(39-2)31(25)40-21-22-11-5-4-6-12-22)19-29-32(37)35(33(38)41-29)20-30(36)34-27-16-9-14-24-13-7-8-15-26(24)27/h3-9,11-19H,1,10,20-21H2,2H3,(H,34,36)/b29-19- |
| InChIKey | HJRVUYBSTJZORV-CEUNXORHSA-N |
| XLogP | 6.83 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|