C29H24BrClN2O5S — CID 126349582
N-(2-bromophenyl)-2-[(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126349582) has the molecular formula C29H24BrClN2O5S and a molecular weight of 627.94 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126349582 |
| Molecular Formula | C29H24BrClN2O5S |
| Molecular Weight | 627.94 g/mol |
| Exact Mass | 626.03 |
| IUPAC Name | N-(2-bromophenyl)-2-[(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | C=CCc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccccc3Br)C2=O)cc(OC)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H24BrClN2O5S/c1-3-6-20-13-19(14-24(37-2)27(20)38-17-18-9-11-21(31)12-10-18)15-25-28(35)33(29(36)39-25)16-26(34)32-23-8-5-4-7-22(23)30/h3-5,7-15H,1,6,16-17H2,2H3,(H,32,34)/b25-15- |
| InChIKey | HUJFUTUDXUPGTR-MYYYXRDXSA-N |
| XLogP | 7.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.94 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|