C22H18BrClN2O5S — CID 126253645
2-[(5E)-5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-chlorophenyl)acetamide (PubChem CID 126253645) has the molecular formula C22H18BrClN2O5S and a molecular weight of 537.82 g/mol. Its IUPAC name is 2-[(5E)-5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126253645 |
| Molecular Formula | C22H18BrClN2O5S |
| Molecular Weight | 537.82 g/mol |
| Exact Mass | 535.98 |
| IUPAC Name | 2-[(5E)-5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-chlorophenyl)acetamide |
| SMILES | C=CCOc1c(Br)cc(/C=C2/SC(=O)N(CC(=O)Nc3ccccc3Cl)C2=O)cc1OC |
| InChI | InChI=1S/C22H18BrClN2O5S/c1-3-8-31-20-14(23)9-13(10-17(20)30-2)11-18-21(28)26(22(29)32-18)12-19(27)25-16-7-5-4-6-15(16)24/h3-7,9-11H,1,8,12H2,2H3,(H,25,27)/b18-11+ |
| InChIKey | HMDLVMXBUXSIFD-WOJGMQOQSA-N |
| XLogP | 5.35 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.82 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|