C27H20BrClN2O7S — CID 126247237
3-[[2-bromo-4-[(E)-[3-[2-(2-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126247237) has the molecular formula C27H20BrClN2O7S and a molecular weight of 631.89 g/mol. Its IUPAC name is 3-[[2-bromo-4-[(E)-[3-[2-(2-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-bromo-4-[(E)-[3-[2-(2-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126247237 |
| Molecular Formula | C27H20BrClN2O7S |
| Molecular Weight | 631.89 g/mol |
| Exact Mass | 629.99 |
| IUPAC Name | 3-[[2-bromo-4-[(E)-[3-[2-(2-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccccc3Cl)C2=O)cc(Br)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C27H20BrClN2O7S/c1-37-21-11-16(10-18(28)24(21)38-14-15-5-4-6-17(9-15)26(34)35)12-22-25(33)31(27(36)39-22)13-23(32)30-20-8-3-2-7-19(20)29/h2-12H,13-14H2,1H3,(H,30,32)(H,34,35)/b22-12+ |
| InChIKey | NBHMGBDXTCFOMB-WSDLNYQXSA-N |
| XLogP | 6.06 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.89 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|