C29H25ClN2O8S — CID 126100671
3-[[2-chloro-4-[(E)-[3-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126100671) has the molecular formula C29H25ClN2O8S and a molecular weight of 597.05 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(E)-[3-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-4-[(E)-[3-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126100671 |
| Molecular Formula | C29H25ClN2O8S |
| Molecular Weight | 597.05 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | 3-[[2-chloro-4-[(E)-[3-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(Cl)c(OCc4cccc(C(=O)O)c4)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C29H25ClN2O8S/c1-3-39-21-9-7-20(8-10-21)31-25(33)15-32-27(34)24(41-29(32)37)14-18-12-22(30)26(23(13-18)38-2)40-16-17-5-4-6-19(11-17)28(35)36/h4-14H,3,15-16H2,1-2H3,(H,31,33)(H,35,36)/b24-14+ |
| InChIKey | DBIZVKWFEALSQT-ZVHZXABRSA-N |
| XLogP | 5.70 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.05 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|