C29H26Cl2N2O6S — CID 126107164
2-[(5E)-5-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 126107164) has the molecular formula C29H26Cl2N2O6S and a molecular weight of 601.51 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126107164 |
| Molecular Formula | C29H26Cl2N2O6S |
| Molecular Weight | 601.51 g/mol |
| Exact Mass | 600.09 |
| IUPAC Name | 2-[(5E)-5-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(Cl)c(OCc4ccccc4Cl)c(OCC)c3)C2=O)cc1 |
| InChI | InChI=1S/C29H26Cl2N2O6S/c1-3-37-21-11-9-20(10-12-21)32-26(34)16-33-28(35)25(40-29(33)36)15-18-13-23(31)27(24(14-18)38-4-2)39-17-19-7-5-6-8-22(19)30/h5-15H,3-4,16-17H2,1-2H3,(H,32,34)/b25-15+ |
| InChIKey | WZCKXOKIAVPFMP-MFKUBSTISA-N |
| XLogP | 7.04 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.51 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|