C28H21Cl2N3O5S — CID 126126003
2-[(5E)-5-[[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 126126003) has the molecular formula C28H21Cl2N3O5S and a molecular weight of 582.47 g/mol. Its IUPAC name is 2-[(5E)-5-[[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126126003 |
| Molecular Formula | C28H21Cl2N3O5S |
| Molecular Weight | 582.47 g/mol |
| Exact Mass | 581.06 |
| IUPAC Name | 2-[(5E)-5-[[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(Cl)c(OCc4ccccc4C#N)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C28H21Cl2N3O5S/c1-2-37-21-9-7-20(8-10-21)32-25(34)15-33-27(35)24(39-28(33)36)13-17-11-22(29)26(23(30)12-17)38-16-19-6-4-3-5-18(19)14-31/h3-13H,2,15-16H2,1H3,(H,32,34)/b24-13+ |
| InChIKey | SQVUFDKCPXVDST-ZMOGYAJESA-N |
| XLogP | 6.52 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.47 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|