C28H21ClFN3O5S — CID 126243020
2-[(5E)-5-[[3-chloro-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 126243020) has the molecular formula C28H21ClFN3O5S and a molecular weight of 566.01 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-chloro-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-chloro-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126243020 |
| Molecular Formula | C28H21ClFN3O5S |
| Molecular Weight | 566.01 g/mol |
| Exact Mass | 565.09 |
| IUPAC Name | 2-[(5E)-5-[[3-chloro-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc(F)c3)C2=O)cc(Cl)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C28H21ClFN3O5S/c1-2-37-23-11-17(10-22(29)26(23)38-16-19-7-4-3-6-18(19)14-31)12-24-27(35)33(28(36)39-24)15-25(34)32-21-9-5-8-20(30)13-21/h3-13H,2,15-16H2,1H3,(H,32,34)/b24-12+ |
| InChIKey | GDAFRBKZNSOWAK-WYMPLXKRSA-N |
| XLogP | 6.00 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.01 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|