C27H19FIN3O5S — CID 126257576
2-[(5E)-5-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 126257576) has the molecular formula C27H19FIN3O5S and a molecular weight of 643.43 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126257576 |
| Molecular Formula | C27H19FIN3O5S |
| Molecular Weight | 643.43 g/mol |
| Exact Mass | 643.01 |
| IUPAC Name | 2-[(5E)-5-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc(F)c3)C2=O)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C27H19FIN3O5S/c1-36-22-10-16(9-21(29)25(22)37-15-18-6-3-2-5-17(18)13-30)11-23-26(34)32(27(35)38-23)14-24(33)31-20-8-4-7-19(28)12-20/h2-12H,14-15H2,1H3,(H,31,33)/b23-11+ |
| InChIKey | PYZFJSBPJALSRO-FOKLQQMPSA-N |
| XLogP | 5.56 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|