C30H26IN3O5S — CID 126376957
2-[(5E)-5-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 126376957) has the molecular formula C30H26IN3O5S and a molecular weight of 667.53 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126376957 |
| Molecular Formula | C30H26IN3O5S |
| Molecular Weight | 667.53 g/mol |
| Exact Mass | 667.06 |
| IUPAC Name | 2-[(5E)-5-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3c(C)cc(C)cc3C)C2=O)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C30H26IN3O5S/c1-17-9-18(2)27(19(3)10-17)33-26(35)15-34-29(36)25(40-30(34)37)13-20-11-23(31)28(24(12-20)38-4)39-16-22-8-6-5-7-21(22)14-32/h5-13H,15-16H2,1-4H3,(H,33,35)/b25-13+ |
| InChIKey | DETABMCRTVDFKT-DHRITJCHSA-N |
| XLogP | 6.35 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|