C22H19IN2O3S2 — CID 5122815
2-[[2-iodo-6-methoxy-4-[(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzonitrile (PubChem CID 5122815) has the molecular formula C22H19IN2O3S2 and a molecular weight of 550.44 g/mol. Its IUPAC name is 2-[[2-iodo-6-methoxy-4-[(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-iodo-6-methoxy-4-[(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 5122815 |
| Molecular Formula | C22H19IN2O3S2 |
| Molecular Weight | 550.44 g/mol |
| Exact Mass | 549.99 |
| IUPAC Name | 2-[[2-iodo-6-methoxy-4-[(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzonitrile |
| SMILES | CCCN1C(=O)C(=Cc2cc(I)c(OCc3ccccc3C#N)c(OC)c2)SC1=S |
| InChI | InChI=1S/C22H19IN2O3S2/c1-3-8-25-21(26)19(30-22(25)29)11-14-9-17(23)20(18(10-14)27-2)28-13-16-7-5-4-6-15(16)12-24/h4-7,9-11H,3,8,13H2,1-2H3 |
| InChIKey | NXEFGNIJLFOJDV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|