C21H17BrN2O3S2 — CID 3338123
2-[[2-bromo-4-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 3338123) has the molecular formula C21H17BrN2O3S2 and a molecular weight of 489.42 g/mol. Its IUPAC name is 2-[[2-bromo-4-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-bromo-4-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 3338123 |
| Molecular Formula | C21H17BrN2O3S2 |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | 2-[[2-bromo-4-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | CCN1C(=O)C(=Cc2cc(Br)c(OCc3ccccc3C#N)c(OC)c2)SC1=S |
| InChI | InChI=1S/C21H17BrN2O3S2/c1-3-24-20(25)18(29-21(24)28)10-13-8-16(22)19(17(9-13)26-2)27-12-15-7-5-4-6-14(15)11-23/h4-10H,3,12H2,1-2H3 |
| InChIKey | BVYVJNWSJWBQGD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|