C25H16ClIN2O3S2 — CID 50871306
2-[[4-[(E)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 50871306) has the molecular formula C25H16ClIN2O3S2 and a molecular weight of 618.91 g/mol. Its IUPAC name is 2-[[4-[(E)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 50871306 |
| Molecular Formula | C25H16ClIN2O3S2 |
| Molecular Weight | 618.91 g/mol |
| Exact Mass | 617.93 |
| IUPAC Name | 2-[[4-[(E)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2/SC(=S)N(c3cccc(Cl)c3)C2=O)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C25H16ClIN2O3S2/c1-31-21-10-15(9-20(27)23(21)32-14-17-6-3-2-5-16(17)13-28)11-22-24(30)29(25(33)34-22)19-8-4-7-18(26)12-19/h2-12H,14H2,1H3/b22-11+ |
| InChIKey | BHJRJOYQPLOBQZ-SSDVNMTOSA-N |
| XLogP | 6.81 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.91 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|