C25H16Cl2N2O3S2 — CID 126357167
2-[[4-[(E)-[3-(3,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzonitrile (PubChem CID 126357167) has the molecular formula C25H16Cl2N2O3S2 and a molecular weight of 527.45 g/mol. Its IUPAC name is 2-[[4-[(E)-[3-(3,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-[3-(3,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126357167 |
| Molecular Formula | C25H16Cl2N2O3S2 |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 526.00 |
| IUPAC Name | 2-[[4-[(E)-[3-(3,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2/SC(=S)N(c3ccc(Cl)c(Cl)c3)C2=O)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C25H16Cl2N2O3S2/c1-31-22-10-15(6-9-21(22)32-14-17-5-3-2-4-16(17)13-28)11-23-24(30)29(25(33)34-23)18-7-8-19(26)20(27)12-18/h2-12H,14H2,1H3/b23-11+ |
| InChIKey | URBKVVPWFWSFFD-FOKLQQMPSA-N |
| XLogP | 6.86 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|