C26H20N2O3S3 — CID 126352528
2-[[2-methoxy-4-[(Z)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126352528) has the molecular formula C26H20N2O3S3 and a molecular weight of 504.66 g/mol. Its IUPAC name is 2-[[2-methoxy-4-[(Z)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-methoxy-4-[(Z)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126352528 |
| Molecular Formula | C26H20N2O3S3 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 2-[[2-methoxy-4-[(Z)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2\SC(=S)N(c3cccc(SC)c3)C2=O)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C26H20N2O3S3/c1-30-23-12-17(10-11-22(23)31-16-19-7-4-3-6-18(19)15-27)13-24-25(29)28(26(32)34-24)20-8-5-9-21(14-20)33-2/h3-14H,16H2,1-2H3/b24-13- |
| InChIKey | LSHCRQWLHILWLA-CFRMEGHHSA-N |
| XLogP | 6.27 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|