C25H17IN2O4S — CID 50871398
2-[[4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 50871398) has the molecular formula C25H17IN2O4S and a molecular weight of 568.39 g/mol. Its IUPAC name is 2-[[4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 50871398 |
| Molecular Formula | C25H17IN2O4S |
| Molecular Weight | 568.39 g/mol |
| Exact Mass | 568.00 |
| IUPAC Name | 2-[[4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2/SC(=O)N(c3ccccc3)C2=O)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C25H17IN2O4S/c1-31-21-12-16(11-20(26)23(21)32-15-18-8-6-5-7-17(18)14-27)13-22-24(29)28(25(30)33-22)19-9-3-2-4-10-19/h2-13H,15H2,1H3/b22-13+ |
| InChIKey | AOJOWLOWMXAJFJ-LPYMAVHISA-N |
| XLogP | 5.99 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.39 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|