C27H19ClN2O5S — CID 126231888
2-[[2-chloro-4-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 126231888) has the molecular formula C27H19ClN2O5S and a molecular weight of 518.98 g/mol. Its IUPAC name is 2-[[2-chloro-4-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-chloro-4-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126231888 |
| Molecular Formula | C27H19ClN2O5S |
| Molecular Weight | 518.98 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 2-[[2-chloro-4-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)c3ccccc3)C2=O)cc(Cl)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C27H19ClN2O5S/c1-34-23-12-17(11-21(28)25(23)35-16-20-10-6-5-9-19(20)14-29)13-24-26(32)30(27(33)36-24)15-22(31)18-7-3-2-4-8-18/h2-13H,15-16H2,1H3/b24-13- |
| InChIKey | QZTPXQUBUJBHDT-CFRMEGHHSA-N |
| XLogP | 5.72 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.98 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|