C25H23ClN2O6S — CID 126211004
[(2S)-butan-2-yl] 2-[(5Z)-5-[[3-chloro-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126211004) has the molecular formula C25H23ClN2O6S and a molecular weight of 514.99 g/mol. Its IUPAC name is [(2S)-butan-2-yl] 2-[(5Z)-5-[[3-chloro-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | [(2S)-butan-2-yl] 2-[(5Z)-5-[[3-chloro-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126211004 |
| Molecular Formula | C25H23ClN2O6S |
| Molecular Weight | 514.99 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | [(2S)-butan-2-yl] 2-[(5Z)-5-[[3-chloro-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC[C@H](C)OC(=O)CN1C(=O)S/C(=C\c2cc(Cl)c(OCc3ccccc3C#N)c(OC)c2)C1=O |
| InChI | InChI=1S/C25H23ClN2O6S/c1-4-15(2)34-22(29)13-28-24(30)21(35-25(28)31)11-16-9-19(26)23(20(10-16)32-3)33-14-18-8-6-5-7-17(18)12-27/h5-11,15H,4,13-14H2,1-3H3/b21-11-/t15-/m0/s1 |
| InChIKey | JNQMBQNRKHPIEX-SYZMQFJCSA-N |
| XLogP | 5.18 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.99 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|