C22H18Cl2N2O3S — CID 126024366
2-[[4-[(E)-[3-[(2S)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-dichlorophenoxy]methyl]benzonitrile (PubChem CID 126024366) has the molecular formula C22H18Cl2N2O3S and a molecular weight of 461.37 g/mol. Its IUPAC name is 2-[[4-[(E)-[3-[(2S)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-dichlorophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-[3-[(2S)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-dichlorophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126024366 |
| Molecular Formula | C22H18Cl2N2O3S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 2-[[4-[(E)-[3-[(2S)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-dichlorophenoxy]methyl]benzonitrile |
| SMILES | CC[C@H](C)N1C(=O)S/C(=C/c2cc(Cl)c(OCc3ccccc3C#N)c(Cl)c2)C1=O |
| InChI | InChI=1S/C22H18Cl2N2O3S/c1-3-13(2)26-21(27)19(30-22(26)28)10-14-8-17(23)20(18(24)9-14)29-12-16-7-5-4-6-15(16)11-25/h4-10,13H,3,12H2,1-2H3/b19-10+/t13-/m0/s1 |
| InChIKey | VUXAAEMCQNOYMQ-UZPSYVQNSA-N |
| XLogP | 6.28 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|