C26H18Cl2N2O3S — CID 126178509
2-[[(5E)-5-[[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126178509) has the molecular formula C26H18Cl2N2O3S and a molecular weight of 509.41 g/mol. Its IUPAC name is 2-[[(5E)-5-[[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-5-[[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126178509 |
| Molecular Formula | C26H18Cl2N2O3S |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 2-[[(5E)-5-[[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | Cc1ccc(COc2c(Cl)cc(/C=C3/SC(=O)N(Cc4ccccc4C#N)C3=O)cc2Cl)cc1 |
| InChI | InChI=1S/C26H18Cl2N2O3S/c1-16-6-8-17(9-7-16)15-33-24-21(27)10-18(11-22(24)28)12-23-25(31)30(26(32)34-23)14-20-5-3-2-4-19(20)13-29/h2-12H,14-15H2,1H3/b23-12+ |
| InChIKey | DPHRVGOZIHFYDX-FSJBWODESA-N |
| XLogP | 6.99 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|