C25H15BrClIN2O3S — CID 126178186
2-[[(5E)-5-[[3-bromo-5-chloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126178186) has the molecular formula C25H15BrClIN2O3S and a molecular weight of 665.73 g/mol. Its IUPAC name is 2-[[(5E)-5-[[3-bromo-5-chloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-5-[[3-bromo-5-chloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126178186 |
| Molecular Formula | C25H15BrClIN2O3S |
| Molecular Weight | 665.73 g/mol |
| Exact Mass | 663.87 |
| IUPAC Name | 2-[[(5E)-5-[[3-bromo-5-chloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1C(=O)S/C(=C/c2cc(Cl)c(OCc3ccc(I)cc3)c(Br)c2)C1=O |
| InChI | InChI=1S/C25H15BrClIN2O3S/c26-20-9-16(10-21(27)23(20)33-14-15-5-7-19(28)8-6-15)11-22-24(31)30(25(32)34-22)13-18-4-2-1-3-17(18)12-29/h1-11H,13-14H2/b22-11+ |
| InChIKey | DGGOAKMKIPRTLY-SSDVNMTOSA-N |
| XLogP | 7.39 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.73 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|