C26H15BrClN3O3S — CID 126173721
2-[[(5E)-5-[[3-bromo-5-chloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126173721) has the molecular formula C26H15BrClN3O3S and a molecular weight of 564.85 g/mol. Its IUPAC name is 2-[[(5E)-5-[[3-bromo-5-chloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-5-[[3-bromo-5-chloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126173721 |
| Molecular Formula | C26H15BrClN3O3S |
| Molecular Weight | 564.85 g/mol |
| Exact Mass | 562.97 |
| IUPAC Name | 2-[[(5E)-5-[[3-bromo-5-chloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(Cl)cc(/C=C2/SC(=O)N(Cc3ccccc3C#N)C2=O)cc1Br |
| InChI | InChI=1S/C26H15BrClN3O3S/c27-21-9-16(10-22(28)24(21)34-15-20-8-4-2-6-18(20)13-30)11-23-25(32)31(26(33)35-23)14-19-7-3-1-5-17(19)12-29/h1-11H,14-15H2/b23-11+ |
| InChIKey | LBGWHEYCGKZSSR-FOKLQQMPSA-N |
| XLogP | 6.66 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.85 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|