C24H19Br2N3O5S — CID 126135318
2-[[2,6-dibromo-4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126135318) has the molecular formula C24H19Br2N3O5S and a molecular weight of 621.31 g/mol. Its IUPAC name is 2-[[2,6-dibromo-4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2,6-dibromo-4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126135318 |
| Molecular Formula | C24H19Br2N3O5S |
| Molecular Weight | 621.31 g/mol |
| Exact Mass | 618.94 |
| IUPAC Name | 2-[[2,6-dibromo-4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(Br)cc(/C=C2/SC(=O)N(CC(=O)N3CCOCC3)C2=O)cc1Br |
| InChI | InChI=1S/C24H19Br2N3O5S/c25-18-9-15(10-19(26)22(18)34-14-17-4-2-1-3-16(17)12-27)11-20-23(31)29(24(32)35-20)13-21(30)28-5-7-33-8-6-28/h1-4,9-11H,5-8,13-14H2/b20-11+ |
| InChIKey | QIBPXDKLHNSPTO-RGVLZGJSSA-N |
| XLogP | 4.56 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|