C27H22I2N2O5S — CID 126145089
(5E)-5-[[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126145089) has the molecular formula C27H22I2N2O5S and a molecular weight of 740.36 g/mol. Its IUPAC name is (5E)-5-[[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126145089 |
| Molecular Formula | C27H22I2N2O5S |
| Molecular Weight | 740.36 g/mol |
| Exact Mass | 739.93 |
| IUPAC Name | (5E)-5-[[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cc(I)c(OCc3cccc4ccccc34)c(I)c2)C1=O)N1CCOCC1 |
| InChI | InChI=1S/C27H22I2N2O5S/c28-21-12-17(13-22(29)25(21)36-16-19-6-3-5-18-4-1-2-7-20(18)19)14-23-26(33)31(27(34)37-23)15-24(32)30-8-10-35-11-9-30/h1-7,12-14H,8-11,15-16H2/b23-14+ |
| InChIKey | IEDVTVLEFXERFQ-OEAKJJBVSA-N |
| XLogP | 5.52 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.36 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|