C32H24Cl2N2O4S — CID 126387181
(5Z)-5-[[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126387181) has the molecular formula C32H24Cl2N2O4S and a molecular weight of 603.53 g/mol. Its IUPAC name is (5Z)-5-[[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126387181 |
| Molecular Formula | C32H24Cl2N2O4S |
| Molecular Weight | 603.53 g/mol |
| Exact Mass | 602.08 |
| IUPAC Name | (5Z)-5-[[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cc(Cl)c(OCc3cccc4ccccc34)c(Cl)c2)C1=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C32H24Cl2N2O4S/c33-26-14-20(15-27(34)30(26)40-19-24-10-5-9-22-7-3-4-11-25(22)24)16-28-31(38)36(32(39)41-28)18-29(37)35-13-12-21-6-1-2-8-23(21)17-35/h1-11,14-16H,12-13,17-19H2/b28-16- |
| InChIKey | VBSBVGPEWGTKNT-NTFVMDSBSA-N |
| XLogP | 7.35 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.53 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|