C28H24Cl2N2O4S — CID 126386683
(5Z)-5-[[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126386683) has the molecular formula C28H24Cl2N2O4S and a molecular weight of 555.48 g/mol. Its IUPAC name is (5Z)-5-[[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126386683 |
| Molecular Formula | C28H24Cl2N2O4S |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | (5Z)-5-[[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cc(Cl)c(OCc3cccc4ccccc34)c(Cl)c2)C1=O)N1CCCCC1 |
| InChI | InChI=1S/C28H24Cl2N2O4S/c29-22-13-18(14-23(30)26(22)36-17-20-9-6-8-19-7-2-3-10-21(19)20)15-24-27(34)32(28(35)37-24)16-25(33)31-11-4-1-5-12-31/h2-3,6-10,13-15H,1,4-5,11-12,16-17H2/b24-15- |
| InChIKey | YBKZAIJCJQIUMO-IWIPYMOSSA-N |
| XLogP | 6.77 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|