C25H24Cl2N2O4S — CID 4034880
3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 4034880) has the molecular formula C25H24Cl2N2O4S and a molecular weight of 519.45 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4034880 |
| Molecular Formula | C25H24Cl2N2O4S |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)SC(=Cc2cc(Cl)c(OCc3ccccc3)c(Cl)c2)C1=O)N1CCCCCC1 |
| InChI | InChI=1S/C25H24Cl2N2O4S/c26-19-12-18(13-20(27)23(19)33-16-17-8-4-3-5-9-17)14-21-24(31)29(25(32)34-21)15-22(30)28-10-6-1-2-7-11-28/h3-5,8-9,12-14H,1-2,6-7,10-11,15-16H2 |
| InChIKey | RDPNICJHVIFJIZ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|