C24H23IN2O4S — CID 126388027
(5Z)-5-[(3-iodo-4-phenylmethoxyphenyl)methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126388027) has the molecular formula C24H23IN2O4S and a molecular weight of 562.43 g/mol. Its IUPAC name is (5Z)-5-[(3-iodo-4-phenylmethoxyphenyl)methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3-iodo-4-phenylmethoxyphenyl)methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126388027 |
| Molecular Formula | C24H23IN2O4S |
| Molecular Weight | 562.43 g/mol |
| Exact Mass | 562.04 |
| IUPAC Name | (5Z)-5-[(3-iodo-4-phenylmethoxyphenyl)methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(OCc3ccccc3)c(I)c2)C1=O)N1CCCCC1 |
| InChI | InChI=1S/C24H23IN2O4S/c25-19-13-18(9-10-20(19)31-16-17-7-3-1-4-8-17)14-21-23(29)27(24(30)32-21)15-22(28)26-11-5-2-6-12-26/h1,3-4,7-10,13-14H,2,5-6,11-12,15-16H2/b21-14- |
| InChIKey | VIHNAGBKRVJGAF-STZFKDTASA-N |
| XLogP | 4.92 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|