C24H22BrClN2O4S — CID 124642842
(5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 124642842) has the molecular formula C24H22BrClN2O4S and a molecular weight of 549.87 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124642842 |
| Molecular Formula | C24H22BrClN2O4S |
| Molecular Weight | 549.87 g/mol |
| Exact Mass | 548.02 |
| IUPAC Name | (5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(OCc3ccccc3Cl)c(Br)c2)C1=O)N1CCCCC1 |
| InChI | InChI=1S/C24H22BrClN2O4S/c25-18-12-16(8-9-20(18)32-15-17-6-2-3-7-19(17)26)13-21-23(30)28(24(31)33-21)14-22(29)27-10-4-1-5-11-27/h2-3,6-9,12-13H,1,4-5,10-11,14-15H2/b21-13+ |
| InChIKey | WCEMJVHHIOZSGK-FYJGNVAPSA-N |
| XLogP | 5.73 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.87 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|