C24H21BrCl2N2O4S — CID 126393643
(5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126393643) has the molecular formula C24H21BrCl2N2O4S and a molecular weight of 584.32 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126393643 |
| Molecular Formula | C24H21BrCl2N2O4S |
| Molecular Weight | 584.32 g/mol |
| Exact Mass | 581.98 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(OCc3ccc(Cl)c(Cl)c3)c(Br)c2)C1=O)N1CCCCC1 |
| InChI | InChI=1S/C24H21BrCl2N2O4S/c25-17-10-15(5-7-20(17)33-14-16-4-6-18(26)19(27)11-16)12-21-23(31)29(24(32)34-21)13-22(30)28-8-2-1-3-9-28/h4-7,10-12H,1-3,8-9,13-14H2/b21-12- |
| InChIKey | ZGCJJNHEVIEWBQ-MTJSOVHGSA-N |
| XLogP | 6.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.32 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|