C27H28Cl2N2O5S — CID 3523240
3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 3523240) has the molecular formula C27H28Cl2N2O5S and a molecular weight of 563.50 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3523240 |
| Molecular Formula | C27H28Cl2N2O5S |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(C=C2SC(=O)N(CC(=O)N3CCCCCC3)C2=O)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H28Cl2N2O5S/c1-2-35-23-14-18(8-10-22(23)36-17-19-7-9-20(28)21(29)13-19)15-24-26(33)31(27(34)37-24)16-25(32)30-11-5-3-4-6-12-30/h7-10,13-15H,2-6,11-12,16-17H2,1H3 |
| InChIKey | PXQQUKXSXWUWKU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|