C26H20Cl2FNO4S — CID 124663933
(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124663933) has the molecular formula C26H20Cl2FNO4S and a molecular weight of 532.42 g/mol. Its IUPAC name is (5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124663933 |
| Molecular Formula | C26H20Cl2FNO4S |
| Molecular Weight | 532.42 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | (5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(Cc3ccc(F)cc3)C2=O)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H20Cl2FNO4S/c1-2-33-23-12-17(6-10-22(23)34-15-18-5-9-20(27)21(28)11-18)13-24-25(31)30(26(32)35-24)14-16-3-7-19(29)8-4-16/h3-13H,2,14-15H2,1H3/b24-13+ |
| InChIKey | LZKVHFDFMCCLLS-ZMOGYAJESA-N |
| XLogP | 7.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.42 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|