C24H26FNO4S — CID 126219707
(5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione (PubChem CID 126219707) has the molecular formula C24H26FNO4S and a molecular weight of 443.54 g/mol. Its IUPAC name is (5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126219707 |
| Molecular Formula | C24H26FNO4S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCCN1C(=O)S/C(=C\c2ccc(OCc3ccc(F)cc3)c(OCC)c2)C1=O |
| InChI | InChI=1S/C24H26FNO4S/c1-3-5-6-13-26-23(27)22(31-24(26)28)15-18-9-12-20(21(14-18)29-4-2)30-16-17-7-10-19(25)11-8-17/h7-12,14-15H,3-6,13,16H2,1-2H3/b22-15- |
| InChIKey | PIRSVKXRIYNDJU-JCMHNJIXSA-N |
| XLogP | 6.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|