C25H26FNO6S — CID 126205731
2-methylpropyl 2-[(5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126205731) has the molecular formula C25H26FNO6S and a molecular weight of 487.55 g/mol. Its IUPAC name is 2-methylpropyl 2-[(5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-methylpropyl 2-[(5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126205731 |
| Molecular Formula | C25H26FNO6S |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 2-methylpropyl 2-[(5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)OCC(C)C)C2=O)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C25H26FNO6S/c1-4-31-21-11-18(7-10-20(21)32-15-17-5-8-19(26)9-6-17)12-22-24(29)27(25(30)34-22)13-23(28)33-14-16(2)3/h5-12,16H,4,13-15H2,1-3H3/b22-12- |
| InChIKey | DDPGHUIDARSABU-UUYOSTAYSA-N |
| XLogP | 5.04 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|