C26H29NO6S — CID 126222101
2-methylpropyl 2-[(5Z)-5-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126222101) has the molecular formula C26H29NO6S and a molecular weight of 483.59 g/mol. Its IUPAC name is 2-methylpropyl 2-[(5Z)-5-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-methylpropyl 2-[(5Z)-5-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126222101 |
| Molecular Formula | C26H29NO6S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2-methylpropyl 2-[(5Z)-5-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)OCC(C)C)C2=O)ccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C26H29NO6S/c1-5-31-22-12-19(9-10-21(22)32-16-20-8-6-7-18(4)11-20)13-23-25(29)27(26(30)34-23)14-24(28)33-15-17(2)3/h6-13,17H,5,14-16H2,1-4H3/b23-13- |
| InChIKey | BYALAHRJDPJYPG-QRVIBDJDSA-N |
| XLogP | 5.21 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|