C29H34N2O7S — CID 126213137
2-methylpropyl 2-[(5E)-5-[[3-ethoxy-4-[2-oxo-2-(2-propan-2-ylanilino)ethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126213137) has the molecular formula C29H34N2O7S and a molecular weight of 554.67 g/mol. Its IUPAC name is 2-methylpropyl 2-[(5E)-5-[[3-ethoxy-4-[2-oxo-2-(2-propan-2-ylanilino)ethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-methylpropyl 2-[(5E)-5-[[3-ethoxy-4-[2-oxo-2-(2-propan-2-ylanilino)ethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126213137 |
| Molecular Formula | C29H34N2O7S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 2-methylpropyl 2-[(5E)-5-[[3-ethoxy-4-[2-oxo-2-(2-propan-2-ylanilino)ethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)OCC(C)C)C2=O)ccc1OCC(=O)Nc1ccccc1C(C)C |
| InChI | InChI=1S/C29H34N2O7S/c1-6-36-24-13-20(14-25-28(34)31(29(35)39-25)15-27(33)38-16-18(2)3)11-12-23(24)37-17-26(32)30-22-10-8-7-9-21(22)19(4)5/h7-14,18-19H,6,15-17H2,1-5H3,(H,30,32)/b25-14+ |
| InChIKey | NIHVCPLHZUZRMU-AFUMVMLFSA-N |
| XLogP | 5.46 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|