C26H28N2O8S — CID 126201553
2-methylpropyl 2-[(5Z)-5-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126201553) has the molecular formula C26H28N2O8S and a molecular weight of 528.58 g/mol. Its IUPAC name is 2-methylpropyl 2-[(5Z)-5-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-methylpropyl 2-[(5Z)-5-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126201553 |
| Molecular Formula | C26H28N2O8S |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 2-methylpropyl 2-[(5Z)-5-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=C2\SC(=O)N(CC(=O)OCC(C)C)C2=O)cc1OC |
| InChI | InChI=1S/C26H28N2O8S/c1-16(2)14-36-24(30)13-28-25(31)22(37-26(28)32)12-17-9-10-20(21(11-17)34-4)35-15-23(29)27-18-7-5-6-8-19(18)33-3/h5-12,16H,13-15H2,1-4H3,(H,27,29)/b22-12- |
| InChIKey | HPMJTEZDWRIJAD-UUYOSTAYSA-N |
| XLogP | 3.96 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|