C28H24IN3O7S — CID 126339027
N-(4-iodophenyl)-2-[(5Z)-5-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126339027) has the molecular formula C28H24IN3O7S and a molecular weight of 673.49 g/mol. Its IUPAC name is N-(4-iodophenyl)-2-[(5Z)-5-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(4-iodophenyl)-2-[(5Z)-5-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126339027 |
| Molecular Formula | C28H24IN3O7S |
| Molecular Weight | 673.49 g/mol |
| Exact Mass | 673.04 |
| IUPAC Name | N-(4-iodophenyl)-2-[(5Z)-5-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(I)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C28H24IN3O7S/c1-37-21-6-4-3-5-20(21)31-26(34)16-39-22-12-7-17(13-23(22)38-2)14-24-27(35)32(28(36)40-24)15-25(33)30-19-10-8-18(29)9-11-19/h3-14H,15-16H2,1-2H3,(H,30,33)(H,31,34)/b24-14- |
| InChIKey | SBTJDTAZJOSVJQ-OYKKKHCWSA-N |
| XLogP | 5.00 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|