C25H24IN3O7S — CID 126357341
N-(4-iodophenyl)-2-[(5Z)-5-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126357341) has the molecular formula C25H24IN3O7S and a molecular weight of 637.45 g/mol. Its IUPAC name is N-(4-iodophenyl)-2-[(5Z)-5-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(4-iodophenyl)-2-[(5Z)-5-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126357341 |
| Molecular Formula | C25H24IN3O7S |
| Molecular Weight | 637.45 g/mol |
| Exact Mass | 637.04 |
| IUPAC Name | N-(4-iodophenyl)-2-[(5Z)-5-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(I)cc3)C2=O)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H24IN3O7S/c1-34-20-12-16(2-7-19(20)36-15-23(31)28-8-10-35-11-9-28)13-21-24(32)29(25(33)37-21)14-22(30)27-18-5-3-17(26)4-6-18/h2-7,12-13H,8-11,14-15H2,1H3,(H,27,30)/b21-13- |
| InChIKey | VBRJWEJTNGSVFZ-BKUYFWCQSA-N |
| XLogP | 3.21 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|