C30H30IN7O7S — CID 126269086
2-[(5Z)-5-[[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide (PubChem CID 126269086) has the molecular formula C30H30IN7O7S and a molecular weight of 759.58 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 126269086 |
| Molecular Formula | C30H30IN7O7S |
| Molecular Weight | 759.58 g/mol |
| Exact Mass | 759.10 |
| IUPAC Name | 2-[(5Z)-5-[[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(I)cc3)C2=O)ccc1Oc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C30H30IN7O7S/c1-42-23-16-19(17-24-26(40)38(30(41)46-24)18-25(39)32-21-5-3-20(31)4-6-21)2-7-22(23)45-29-34-27(36-8-12-43-13-9-36)33-28(35-29)37-10-14-44-15-11-37/h2-7,16-17H,8-15,18H2,1H3,(H,32,39)/b24-17- |
| InChIKey | KRLZPLAWMYPYOC-ULJHMMPZSA-N |
| XLogP | 3.63 |
| TPSA | 148.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|