C29H27N3O8S2 — CID 126153557
[2-methoxy-4-[(Z)-[3-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzenesulfonate (PubChem CID 126153557) has the molecular formula C29H27N3O8S2 and a molecular weight of 609.68 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[3-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [2-methoxy-4-[(Z)-[3-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126153557 |
| Molecular Formula | C29H27N3O8S2 |
| Molecular Weight | 609.68 g/mol |
| Exact Mass | 609.12 |
| IUPAC Name | [2-methoxy-4-[(Z)-[3-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzenesulfonate |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(N4CCOCC4)cc3)C2=O)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H27N3O8S2/c1-38-25-17-20(7-12-24(25)40-42(36,37)23-5-3-2-4-6-23)18-26-28(34)32(29(35)41-26)19-27(33)30-21-8-10-22(11-9-21)31-13-15-39-16-14-31/h2-12,17-18H,13-16,19H2,1H3,(H,30,33)/b26-18- |
| InChIKey | XYEDFIGQYANBQZ-ITYLOYPMSA-N |
| XLogP | 3.97 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.68 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|