C24H24BrN3O6S — CID 126152078
2-[(5E)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 126152078) has the molecular formula C24H24BrN3O6S and a molecular weight of 562.44 g/mol. Its IUPAC name is 2-[(5E)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126152078 |
| Molecular Formula | C24H24BrN3O6S |
| Molecular Weight | 562.44 g/mol |
| Exact Mass | 561.06 |
| IUPAC Name | 2-[(5E)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(N4CCOCC4)cc3)C2=O)cc(Br)c1OC |
| InChI | InChI=1S/C24H24BrN3O6S/c1-32-19-12-15(11-18(25)22(19)33-2)13-20-23(30)28(24(31)35-20)14-21(29)26-16-3-5-17(6-4-16)27-7-9-34-10-8-27/h3-6,11-13H,7-10,14H2,1-2H3,(H,26,29)/b20-13+ |
| InChIKey | PRELSMFAYNRYTO-DEDYPNTBSA-N |
| XLogP | 3.98 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|