C27H28BrN3O8S — CID 126146856
methyl 2-[2-bromo-6-ethoxy-4-[(Z)-[3-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126146856) has the molecular formula C27H28BrN3O8S and a molecular weight of 634.51 g/mol. Its IUPAC name is methyl 2-[2-bromo-6-ethoxy-4-[(Z)-[3-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-6-ethoxy-4-[(Z)-[3-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126146856 |
| Molecular Formula | C27H28BrN3O8S |
| Molecular Weight | 634.51 g/mol |
| Exact Mass | 633.08 |
| IUPAC Name | methyl 2-[2-bromo-6-ethoxy-4-[(Z)-[3-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(N4CCOCC4)cc3)C2=O)cc(Br)c1OCC(=O)OC |
| InChI | InChI=1S/C27H28BrN3O8S/c1-3-38-21-13-17(12-20(28)25(21)39-16-24(33)36-2)14-22-26(34)31(27(35)40-22)15-23(32)29-18-4-6-19(7-5-18)30-8-10-37-11-9-30/h4-7,12-14H,3,8-11,15-16H2,1-2H3,(H,29,32)/b22-14- |
| InChIKey | JHGLVNHEASHEMQ-HMAPJEAMSA-N |
| XLogP | 3.91 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|