C23H19BrClFN2O7S — CID 126233521
methyl 2-[2-bromo-4-[(Z)-[3-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetate (PubChem CID 126233521) has the molecular formula C23H19BrClFN2O7S and a molecular weight of 601.83 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[(Z)-[3-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[(Z)-[3-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126233521 |
| Molecular Formula | C23H19BrClFN2O7S |
| Molecular Weight | 601.83 g/mol |
| Exact Mass | 599.98 |
| IUPAC Name | methyl 2-[2-bromo-4-[(Z)-[3-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(F)c(Cl)c3)C2=O)cc(Br)c1OCC(=O)OC |
| InChI | InChI=1S/C23H19BrClFN2O7S/c1-3-34-17-7-12(6-14(24)21(17)35-11-20(30)33-2)8-18-22(31)28(23(32)36-18)10-19(29)27-13-4-5-16(26)15(25)9-13/h4-9H,3,10-11H2,1-2H3,(H,27,29)/b18-8- |
| InChIKey | XPXOJYMYZWKELS-LSCVHKIXSA-N |
| XLogP | 4.87 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.83 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|