C20H15BrClFN2O5S — CID 126231833
2-[(5E)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-chloro-4-fluorophenyl)acetamide (PubChem CID 126231833) has the molecular formula C20H15BrClFN2O5S and a molecular weight of 529.77 g/mol. Its IUPAC name is 2-[(5E)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-chloro-4-fluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-chloro-4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126231833 |
| Molecular Formula | C20H15BrClFN2O5S |
| Molecular Weight | 529.77 g/mol |
| Exact Mass | 527.96 |
| IUPAC Name | 2-[(5E)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-chloro-4-fluorophenyl)acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(F)c(Cl)c3)C2=O)cc(Br)c1OC |
| InChI | InChI=1S/C20H15BrClFN2O5S/c1-29-15-6-10(5-12(21)18(15)30-2)7-16-19(27)25(20(28)31-16)9-17(26)24-11-3-4-14(23)13(22)8-11/h3-8H,9H2,1-2H3,(H,24,26)/b16-7+ |
| InChIKey | QJBIFGWXATZSDM-FRKPEAEDSA-N |
| XLogP | 4.93 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.77 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|