C21H18ClFN2O6S — CID 126231265
N-(3-chloro-4-fluorophenyl)-2-[(5E)-2,4-dioxo-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126231265) has the molecular formula C21H18ClFN2O6S and a molecular weight of 480.90 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[(5E)-2,4-dioxo-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[(5E)-2,4-dioxo-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126231265 |
| Molecular Formula | C21H18ClFN2O6S |
| Molecular Weight | 480.90 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[(5E)-2,4-dioxo-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C1/SC(=O)N(CC(=O)Nc2ccc(F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C21H18ClFN2O6S/c1-29-15-9-17(31-3)16(30-2)6-11(15)7-18-20(27)25(21(28)32-18)10-19(26)24-12-4-5-14(23)13(22)8-12/h4-9H,10H2,1-3H3,(H,24,26)/b18-7+ |
| InChIKey | NGAJRPOMUMQFBH-CNHKJKLMSA-N |
| XLogP | 4.18 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.90 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|