C29H26FN3O6S — CID 126278070
2-[(5Z)-5-[[4-[2-(4-ethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 126278070) has the molecular formula C29H26FN3O6S and a molecular weight of 563.61 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-[2-(4-ethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[4-[2-(4-ethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126278070 |
| Molecular Formula | C29H26FN3O6S |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 2-[(5Z)-5-[[4-[2-(4-ethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)COc2ccc(/C=C3\SC(=O)N(CC(=O)Nc4ccc(F)cc4)C3=O)cc2OC)cc1 |
| InChI | InChI=1S/C29H26FN3O6S/c1-3-18-4-9-21(10-5-18)32-27(35)17-39-23-13-6-19(14-24(23)38-2)15-25-28(36)33(29(37)40-25)16-26(34)31-22-11-7-20(30)8-12-22/h4-15H,3,16-17H2,1-2H3,(H,31,34)(H,32,35)/b25-15- |
| InChIKey | DZQNLHDTIUSOID-MYYYXRDXSA-N |
| XLogP | 5.09 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|